Datasheet Details
| Part number | SH88F516 |
|---|---|
| Manufacturer | SINO WEALTH |
| File Size | 1.01 MB |
| Description | 8051 Microcontroller |
| Datasheet | SH88F516-SINOWEALTH.pdf |
|
|
|
Overview: SH88F516(SH88F54/SH89F52) 8051 Microcontroller with 10bit ADC 1.
| Part number | SH88F516 |
|---|---|
| Manufacturer | SINO WEALTH |
| File Size | 1.01 MB |
| Description | 8051 Microcontroller |
| Datasheet | SH88F516-SINOWEALTH.pdf |
|
|
|
The SH88F516 is a high performance 8051 patible micro-controller, regard to its build-in Pipe-line instruction fetch structure, that helps the SH88F516 can perform more fast operation speed and higher calculation performance, if pare SH88F516 with standard 8051 at same clock speed.
The SH88F516 retains most
| Part Number | Description |
|---|---|
| SH88F52 | 8051 Microcontroller |
| SH88F54 | 8051 Microcontroller |
| SH88F2051A | Enhanced 8051 Microcontroller |
| SH88F4051A | Enhanced 8051 Microcontroller |
| SH88F6161 | Enhanced 8051 Microcontroller |
| SH88F6162 | Enhanced 8051 Microcontroller |
| SH87F8801 | Bluetooth 4.0 low power single mode processor |
| SH89F52 | 8051 Microcontroller |